C23H18ClN3O2S2 — CID 23938457
2-(4-chlorophenyl)sulfanyl-N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide (PubChem CID 23938457) has the molecular formula C23H18ClN3O2S2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 23938457 |
| Molecular Formula | C23H18ClN3O2S2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide |
| SMILES | Cc1cccc(-c2nc3cc(NC(=S)NC(=O)CSc4ccc(Cl)cc4)ccc3o2)c1 |
| InChI | InChI=1S/C23H18ClN3O2S2/c1-14-3-2-4-15(11-14)22-26-19-12-17(7-10-20(19)29-22)25-23(30)27-21(28)13-31-18-8-5-16(24)6-9-18/h2-12H,13H2,1H3,(H2,25,27,28,30) |
| InChIKey | ATVFCNMAJKUUMW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|