C23H18ClN3O3S2 — CID 23935376
2-(4-chlorophenyl)sulfanyl-N-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide (PubChem CID 23935376) has the molecular formula C23H18ClN3O3S2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 23935376 |
| Molecular Formula | C23H18ClN3O3S2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[[2-(4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=S)NC(=O)CSc4ccc(Cl)cc4)ccc3o2)cc1 |
| InChI | InChI=1S/C23H18ClN3O3S2/c1-29-17-7-2-14(3-8-17)22-26-19-12-16(6-11-20(19)30-22)25-23(31)27-21(28)13-32-18-9-4-15(24)5-10-18/h2-12H,13H2,1H3,(H2,25,27,28,31) |
| InChIKey | GWSIYYIAMNMJQB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|