C22H14Cl3N3O2S2 — CID 23990798
2-(4-chlorophenyl)sulfanyl-N-[[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide (PubChem CID 23990798) has the molecular formula C22H14Cl3N3O2S2 and a molecular weight of 522.87 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 23990798 |
| Molecular Formula | C22H14Cl3N3O2S2 |
| Molecular Weight | 522.87 g/mol |
| Exact Mass | 520.96 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[[2-(2,3-dichlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NC(=S)Nc1ccc2oc(-c3cccc(Cl)c3Cl)nc2c1 |
| InChI | InChI=1S/C22H14Cl3N3O2S2/c23-12-4-7-14(8-5-12)32-11-19(29)28-22(31)26-13-6-9-18-17(10-13)27-21(30-18)15-2-1-3-16(24)20(15)25/h1-10H,11H2,(H2,26,28,29,31) |
| InChIKey | WXGIGGAPKNVUDI-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.87 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|