C19H15NO9S — CID 70459027
4-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,3-dicarboxyoxypropyl]benzoic acid (PubChem CID 70459027) has the molecular formula C19H15NO9S and a molecular weight of 433.39 g/mol. Its IUPAC name is 4-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,3-dicarboxyoxypropyl]benzoic acid.
| Compound Name | 4-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,3-dicarboxyoxypropyl]benzoic acid |
|---|---|
| PubChem CID | 70459027 |
| Molecular Formula | C19H15NO9S |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 4-[1-(1,3-benzoxazol-2-ylsulfanyl)-2,3-dicarboxyoxypropyl]benzoic acid |
| SMILES | O=C(O)OCC(OC(=O)O)C(Sc1nc2ccccc2o1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H15NO9S/c21-16(22)11-7-5-10(6-8-11)15(14(29-19(25)26)9-27-18(23)24)30-17-20-12-3-1-2-4-13(12)28-17/h1-8,14-15H,9H2,(H,21,22)(H,23,24)(H,25,26) |
| InChIKey | VGNJQOCNCXASCS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 156.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |