C13H14N4O4S — CID 10245558
methyl (3Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(carbamoylhydrazinylidene)butanoate (PubChem CID 10245558) has the molecular formula C13H14N4O4S and a molecular weight of 322.35 g/mol. Its IUPAC name is methyl (3Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(carbamoylhydrazinylidene)butanoate.
| Compound Name | methyl (3Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(carbamoylhydrazinylidene)butanoate |
|---|---|
| PubChem CID | 10245558 |
| Molecular Formula | C13H14N4O4S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl (3Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(carbamoylhydrazinylidene)butanoate |
| SMILES | COC(=O)C(Sc1nc2ccccc2o1)/C(C)=N\NC(N)=O |
| InChI | InChI=1S/C13H14N4O4S/c1-7(16-17-12(14)19)10(11(18)20-2)22-13-15-8-5-3-4-6-9(8)21-13/h3-6,10H,1-2H3,(H3,14,17,19)/b16-7- |
| InChIKey | SCGXMKPILZFFSB-APSNUPSMSA-N |
| XLogP | 1.51 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|