C16H20N4OS — CID 51982672
(2S)-N-cyclohexyl-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 51982672) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | (2S)-N-cyclohexyl-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 51982672 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (2S)-N-cyclohexyl-2-phenyl-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | O=C(NC1CCCCC1)[C@@H](Sc1ncn[nH]1)c1ccccc1 |
| InChI | InChI=1S/C16H20N4OS/c21-15(19-13-9-5-2-6-10-13)14(12-7-3-1-4-8-12)22-16-17-11-18-20-16/h1,3-4,7-8,11,13-14H,2,5-6,9-10H2,(H,19,21)(H,17,18,20)/t14-/m0/s1 |
| InChIKey | ZFZNCXGMWBYYNE-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |