C22H25N3OS — CID 25239359
N-cyclohexyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetamide (PubChem CID 25239359) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is N-cyclohexyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 25239359 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | N-cyclohexyl-2-[(6-methyl-1H-benzimidazol-2-yl)sulfanyl]-2-phenylacetamide |
| SMILES | Cc1ccc2nc(SC(C(=O)NC3CCCCC3)c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C22H25N3OS/c1-15-12-13-18-19(14-15)25-22(24-18)27-20(16-8-4-2-5-9-16)21(26)23-17-10-6-3-7-11-17/h2,4-5,8-9,12-14,17,20H,3,6-7,10-11H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | OJEKAPRBAZNOQF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |