C20H21N3O2S — CID 40511290
(2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenyl-1-pyrrolidin-1-ylethanone (PubChem CID 40511290) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is (2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenyl-1-pyrrolidin-1-ylethanone.
| Compound Name | (2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 40511290 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | (2R)-2-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]-2-phenyl-1-pyrrolidin-1-ylethanone |
| SMILES | COc1ccc2nc(S[C@@H](C(=O)N3CCCC3)c3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C20H21N3O2S/c1-25-15-9-10-16-17(13-15)22-20(21-16)26-18(14-7-3-2-4-8-14)19(24)23-11-5-6-12-23/h2-4,7-10,13,18H,5-6,11-12H2,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | GFBJKMZHYYCEQI-GOSISDBHSA-N |
| XLogP | 4.03 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |