C19H20F3N3OS — CID 86207793
N-cyclohexyl-2-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 86207793) has the molecular formula C19H20F3N3OS and a molecular weight of 395.45 g/mol. Its IUPAC name is N-cyclohexyl-2-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-cyclohexyl-2-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 86207793 |
| Molecular Formula | C19H20F3N3OS |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N-cyclohexyl-2-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | O=C(NC1CCCCC1)C(Sc1nccc(C(F)(F)F)n1)c1ccccc1 |
| InChI | InChI=1S/C19H20F3N3OS/c20-19(21,22)15-11-12-23-18(25-15)27-16(13-7-3-1-4-8-13)17(26)24-14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14,16H,2,5-6,9-10H2,(H,24,26) |
| InChIKey | VVYNOTLPOWYDAM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |