C8H14N2OS — CID 100726062
(2R)-1-[(5-ethyl-1H-imidazol-2-yl)sulfanyl]propan-2-ol (PubChem CID 100726062) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is (2R)-1-[(5-ethyl-1H-imidazol-2-yl)sulfanyl]propan-2-ol.
| Compound Name | (2R)-1-[(5-ethyl-1H-imidazol-2-yl)sulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 100726062 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (2R)-1-[(5-ethyl-1H-imidazol-2-yl)sulfanyl]propan-2-ol |
| SMILES | CCc1cnc(SC[C@@H](C)O)[nH]1 |
| InChI | InChI=1S/C8H14N2OS/c1-3-7-4-9-8(10-7)12-5-6(2)11/h4,6,11H,3,5H2,1-2H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | BXSGDAVSJXLNAN-ZCFIWIBFSA-N |
| XLogP | 1.45 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |