C10H8N4S — CID 728267
2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzonitrile (PubChem CID 728267) has the molecular formula C10H8N4S and a molecular weight of 216.27 g/mol. Its IUPAC name is 2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzonitrile.
| Compound Name | 2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzonitrile |
|---|---|
| PubChem CID | 728267 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzonitrile |
| SMILES | N#Cc1ccccc1CSc1ncn[nH]1 |
| InChI | InChI=1S/C10H8N4S/c11-5-8-3-1-2-4-9(8)6-15-10-12-7-13-14-10/h1-4,7H,6H2,(H,12,13,14) |
| InChIKey | GMRJGXUYTWUBAX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |