About CID 143152957
CID 143152957 (PubChem CID 143152957) has the molecular formula C8H6AlNS
and a molecular weight of 175.19 g/mol.
Molecular Properties
| Compound Name | CID 143152957 |
| PubChem CID | 143152957 |
| Molecular Formula | C8H6AlNS |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | — |
| SMILES | N#Cc1ccccc1CS[Al] |
| InChI | InChI=1S/C8H7NS.Al/c9-5-7-3-1-2-4-8(7)6-10;/h1-4,10H,6H2;/q;+1/p-1 |
| InChIKey | LJAKDWFXCNKECJ-UHFFFAOYSA-M |
| XLogP | 1.87 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 143152957 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143152957?
The IUPAC name of CID 143152957 (CID 143152957) is not available.
What is the SMILES notation for CID 143152957?
The canonical SMILES for CID 143152957 is N#Cc1ccccc1CS[Al].
What is the InChIKey of CID 143152957?
The InChIKey is LJAKDWFXCNKECJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7NS.Al/c9-5-7-3-1-2-4-8(7)6-10;/h1-4,10H,6H2;/q;+1/p-1.
What are the key properties of CID 143152957?
CID 143152957 has a molecular weight of 175.19 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143152957 is sourced from PubChem (CID 143152957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).