C17H17NS — CID 71628583
2-[(3,5-dimethylphenyl)methylsulfanylmethyl]benzonitrile (PubChem CID 71628583) has the molecular formula C17H17NS and a molecular weight of 267.40 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfanylmethyl]benzonitrile.
| Compound Name | 2-[(3,5-dimethylphenyl)methylsulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 71628583 |
| Molecular Formula | C17H17NS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methylsulfanylmethyl]benzonitrile |
| SMILES | Cc1cc(C)cc(CSCc2ccccc2C#N)c1 |
| InChI | InChI=1S/C17H17NS/c1-13-7-14(2)9-15(8-13)11-19-12-17-6-4-3-5-16(17)10-18/h3-9H,11-12H2,1-2H3 |
| InChIKey | AOEISZYIUHKYRA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |