About 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide
2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide (PubChem CID 20997813) has the molecular formula C15H12BrN3S
and a molecular weight of 346.25 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide.
Molecular Properties
| Compound Name | 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide |
| PubChem CID | 20997813 |
| Molecular Formula | C15H12BrN3S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide |
| SMILES | Br.N#Cc1ccccc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H11N3S.BrH/c16-9-11-5-1-2-6-12(11)10-19-15-17-13-7-3-4-8-14(13)18-15;/h1-8H,10H2,(H,17,18);1H |
| InChIKey | MULJXYLFGYAKJR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide?
The IUPAC name of 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide (CID 20997813) is 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide.
What is the SMILES notation for 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide?
The canonical SMILES for 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide is Br.N#Cc1ccccc1CSc1nc2ccccc2[nH]1.
What is the InChIKey of 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide?
The InChIKey is MULJXYLFGYAKJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3S.BrH/c16-9-11-5-1-2-6-12(11)10-19-15-17-13-7-3-4-8-14(13)18-15;/h1-8H,10H2,(H,17,18);1H.
What are the key properties of 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide?
2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide has a molecular weight of 346.25 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-benzimidazol-2-ylsulfanylmethyl)benzonitrile;hydrobromide is sourced from PubChem (CID 20997813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).