C16H14FN3S — CID 107118520
2-fluoro-3-(1H-indol-2-ylsulfanylmethyl)benzenecarboximidamide (PubChem CID 107118520) has the molecular formula C16H14FN3S and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-fluoro-3-(1H-indol-2-ylsulfanylmethyl)benzenecarboximidamide.
| Compound Name | 2-fluoro-3-(1H-indol-2-ylsulfanylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 107118520 |
| Molecular Formula | C16H14FN3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-fluoro-3-(1H-indol-2-ylsulfanylmethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(CSc2cc3ccccc3[nH]2)c1F |
| InChI | InChI=1S/C16H14FN3S/c17-15-11(5-3-6-12(15)16(18)19)9-21-14-8-10-4-1-2-7-13(10)20-14/h1-8,20H,9H2,(H3,18,19) |
| InChIKey | JUJZBYDMRVTKQN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 65.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|