C17H20N2O4 — CID 136587475
[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-methoxy-1H-indol-2-yl)methanone (PubChem CID 136587475) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-methoxy-1H-indol-2-yl)methanone.
| Compound Name | [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-methoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 136587475 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-(4-methoxy-1H-indol-2-yl)methanone |
| SMILES | COc1cccc2[nH]c(C(=O)N3CCO[C@@H]4COCC[C@@H]43)cc12 |
| InChI | InChI=1S/C17H20N2O4/c1-21-15-4-2-3-12-11(15)9-13(18-12)17(20)19-6-8-23-16-10-22-7-5-14(16)19/h2-4,9,14,16,18H,5-8,10H2,1H3/t14-,16+/m0/s1 |
| InChIKey | BBWXBSMQERILSR-GOEBONIOSA-N |
| XLogP | 1.81 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |