C20H25N3O7 — CID 171712199
formic acid;2-[(1S,5R)-7-(4-methoxy-1H-indole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-9-yl]acetic acid (PubChem CID 171712199) has the molecular formula C20H25N3O7 and a molecular weight of 419.43 g/mol. Its IUPAC name is formic acid;2-[(1S,5R)-7-(4-methoxy-1H-indole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-9-yl]acetic acid.
| Compound Name | formic acid;2-[(1S,5R)-7-(4-methoxy-1H-indole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-9-yl]acetic acid |
|---|---|
| PubChem CID | 171712199 |
| Molecular Formula | C20H25N3O7 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | formic acid;2-[(1S,5R)-7-(4-methoxy-1H-indole-2-carbonyl)-3-oxa-7,9-diazabicyclo[3.3.2]decan-9-yl]acetic acid |
| SMILES | COc1cccc2[nH]c(C(=O)N3C[C@@H]4COC[C@H](C3)N(CC(=O)O)C4)cc12.O=CO |
| InChI | InChI=1S/C19H23N3O5.CH2O2/c1-26-17-4-2-3-15-14(17)5-16(20-15)19(25)22-7-12-6-21(9-18(23)24)13(8-22)11-27-10-12;2-1-3/h2-5,12-13,20H,6-11H2,1H3,(H,23,24);1H,(H,2,3)/t12-,13+;/m1./s1 |
| InChIKey | NCEIAMDRMJSJED-KZCZEQIWSA-N |
| XLogP | 0.73 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|