C19H16N2O4S — CID 45180406
5-[1-(4-oxochromene-2-carbonyl)pyrrolidin-2-yl]thiophene-2-carboxamide (PubChem CID 45180406) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is 5-[1-(4-oxochromene-2-carbonyl)pyrrolidin-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-[1-(4-oxochromene-2-carbonyl)pyrrolidin-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 45180406 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-[1-(4-oxochromene-2-carbonyl)pyrrolidin-2-yl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(C2CCCN2C(=O)c2cc(=O)c3ccccc3o2)s1 |
| InChI | InChI=1S/C19H16N2O4S/c20-18(23)17-8-7-16(26-17)12-5-3-9-21(12)19(24)15-10-13(22)11-4-1-2-6-14(11)25-15/h1-2,4,6-8,10,12H,3,5,9H2,(H2,20,23) |
| InChIKey | CWELAHUXTQKFKZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |