C15H12ClFN4O2 — CID 167895155
(5-chloro-1-methylimidazol-2-yl)methyl 3-(2-fluorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 167895155) has the molecular formula C15H12ClFN4O2 and a molecular weight of 334.74 g/mol. Its IUPAC name is (5-chloro-1-methylimidazol-2-yl)methyl 3-(2-fluorophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | (5-chloro-1-methylimidazol-2-yl)methyl 3-(2-fluorophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 167895155 |
| Molecular Formula | C15H12ClFN4O2 |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (5-chloro-1-methylimidazol-2-yl)methyl 3-(2-fluorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | Cn1c(Cl)cnc1COC(=O)c1cc(-c2ccccc2F)n[nH]1 |
| InChI | InChI=1S/C15H12ClFN4O2/c1-21-13(16)7-18-14(21)8-23-15(22)12-6-11(19-20-12)9-4-2-3-5-10(9)17/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | UJELLZCGORXWSB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |