C24H21N3O — CID 18870925
N,N-dibenzyl-3-phenyl-1H-pyrazole-5-carboxamide (PubChem CID 18870925) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is N,N-dibenzyl-3-phenyl-1H-pyrazole-5-carboxamide.
| Compound Name | N,N-dibenzyl-3-phenyl-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 18870925 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N,N-dibenzyl-3-phenyl-1H-pyrazole-5-carboxamide |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H21N3O/c28-24(23-16-22(25-26-23)21-14-8-3-9-15-21)27(17-19-10-4-1-5-11-19)18-20-12-6-2-7-13-20/h1-16H,17-18H2,(H,25,26) |
| InChIKey | MCCRNOWDJIKDLM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |