C18H15N5O — CID 166405265
N-(cyanomethyl)-3-phenyl-N-(pyridin-2-ylmethyl)-1H-pyrazole-5-carboxamide (PubChem CID 166405265) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(cyanomethyl)-3-phenyl-N-(pyridin-2-ylmethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(cyanomethyl)-3-phenyl-N-(pyridin-2-ylmethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 166405265 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-(cyanomethyl)-3-phenyl-N-(pyridin-2-ylmethyl)-1H-pyrazole-5-carboxamide |
| SMILES | N#CCN(Cc1ccccn1)C(=O)c1cc(-c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C18H15N5O/c19-9-11-23(13-15-8-4-5-10-20-15)18(24)17-12-16(21-22-17)14-6-2-1-3-7-14/h1-8,10,12H,11,13H2,(H,21,22) |
| InChIKey | TUDVKXHGKJTPDP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|