C22H25N5O2 — CID 131895533
3-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)-1H-pyrazole-5-carboxamide (PubChem CID 131895533) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 131895533 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 3-(4-methylphenyl)-N-(2-morpholin-4-yl-2-pyridin-3-ylethyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCC(c3cccnc3)N3CCOCC3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H25N5O2/c1-16-4-6-17(7-5-16)19-13-20(26-25-19)22(28)24-15-21(18-3-2-8-23-14-18)27-9-11-29-12-10-27/h2-8,13-14,21H,9-12,15H2,1H3,(H,24,28)(H,25,26) |
| InChIKey | OIPSEUBCOBYCKN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |