C17H15ClN4O2 — CID 155944607
N-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-5-pyridin-3-yl-1H-pyrazole-4-carboxamide (PubChem CID 155944607) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is N-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-5-pyridin-3-yl-1H-pyrazole-4-carboxamide.
| Compound Name | N-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-5-pyridin-3-yl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155944607 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]-5-pyridin-3-yl-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1cccc(Cl)c1)c1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C17H15ClN4O2/c18-13-5-1-3-11(7-13)15(23)10-20-17(24)14-9-21-22-16(14)12-4-2-6-19-8-12/h1-9,15,23H,10H2,(H,20,24)(H,21,22)/t15-/m1/s1 |
| InChIKey | MQSRMNFIJLKRSM-OAHLLOKOSA-N |
| XLogP | 2.59 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |