C18H15F2N3O2 — CID 97320264
5-(2-fluorophenyl)-N-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide (PubChem CID 97320264) has the molecular formula C18H15F2N3O2 and a molecular weight of 343.33 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 97320264 |
| Molecular Formula | C18H15F2N3O2 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[(2S)-2-(3-fluorophenyl)-2-hydroxyethyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC[C@@H](O)c1cccc(F)c1)c1cn[nH]c1-c1ccccc1F |
| InChI | InChI=1S/C18H15F2N3O2/c19-12-5-3-4-11(8-12)16(24)10-21-18(25)14-9-22-23-17(14)13-6-1-2-7-15(13)20/h1-9,16,24H,10H2,(H,21,25)(H,22,23)/t16-/m1/s1 |
| InChIKey | UTIOTLHBTGPQSB-MRXNPFEDSA-N |
| XLogP | 2.82 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |