C19H18FN3O2 — CID 97051849
5-(2-fluorophenyl)-N-[(3R)-3-hydroxy-3-phenylpropyl]-1H-pyrazole-4-carboxamide (PubChem CID 97051849) has the molecular formula C19H18FN3O2 and a molecular weight of 339.37 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[(3R)-3-hydroxy-3-phenylpropyl]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[(3R)-3-hydroxy-3-phenylpropyl]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 97051849 |
| Molecular Formula | C19H18FN3O2 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[(3R)-3-hydroxy-3-phenylpropyl]-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCC[C@@H](O)c1ccccc1)c1cn[nH]c1-c1ccccc1F |
| InChI | InChI=1S/C19H18FN3O2/c20-16-9-5-4-8-14(16)18-15(12-22-23-18)19(25)21-11-10-17(24)13-6-2-1-3-7-13/h1-9,12,17,24H,10-11H2,(H,21,25)(H,22,23)/t17-/m1/s1 |
| InChIKey | VOKYGVPXQDLAKK-QGZVFWFLSA-N |
| XLogP | 3.07 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |