C17H18FN5O — CID 75378535
5-(2-fluorophenyl)-N-(4-imidazol-1-ylbutyl)-1H-pyrazole-4-carboxamide (PubChem CID 75378535) has the molecular formula C17H18FN5O and a molecular weight of 327.36 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-(4-imidazol-1-ylbutyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-(4-imidazol-1-ylbutyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 75378535 |
| Molecular Formula | C17H18FN5O |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 5-(2-fluorophenyl)-N-(4-imidazol-1-ylbutyl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NCCCCn1ccnc1)c1cn[nH]c1-c1ccccc1F |
| InChI | InChI=1S/C17H18FN5O/c18-15-6-2-1-5-13(15)16-14(11-21-22-16)17(24)20-7-3-4-9-23-10-8-19-12-23/h1-2,5-6,8,10-12H,3-4,7,9H2,(H,20,24)(H,21,22) |
| InChIKey | NNPNTPKPENJONK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|