C15H17ClFN3O — CID 110445786
2-chloro-6-fluoro-N-(5-imidazol-1-ylpentyl)benzamide (PubChem CID 110445786) has the molecular formula C15H17ClFN3O and a molecular weight of 309.77 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-(5-imidazol-1-ylpentyl)benzamide.
| Compound Name | 2-chloro-6-fluoro-N-(5-imidazol-1-ylpentyl)benzamide |
|---|---|
| PubChem CID | 110445786 |
| Molecular Formula | C15H17ClFN3O |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-chloro-6-fluoro-N-(5-imidazol-1-ylpentyl)benzamide |
| SMILES | O=C(NCCCCCn1ccnc1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H17ClFN3O/c16-12-5-4-6-13(17)14(12)15(21)19-7-2-1-3-9-20-10-8-18-11-20/h4-6,8,10-11H,1-3,7,9H2,(H,19,21) |
| InChIKey | WBRFQOVMRVBJPB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|