C15H17Cl2N3O2 — CID 110443039
3,6-dichloro-N-(4-imidazol-1-ylbutyl)-2-methoxybenzamide (PubChem CID 110443039) has the molecular formula C15H17Cl2N3O2 and a molecular weight of 342.23 g/mol. Its IUPAC name is 3,6-dichloro-N-(4-imidazol-1-ylbutyl)-2-methoxybenzamide.
| Compound Name | 3,6-dichloro-N-(4-imidazol-1-ylbutyl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 110443039 |
| Molecular Formula | C15H17Cl2N3O2 |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3,6-dichloro-N-(4-imidazol-1-ylbutyl)-2-methoxybenzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)NCCCCn1ccnc1 |
| InChI | InChI=1S/C15H17Cl2N3O2/c1-22-14-12(17)5-4-11(16)13(14)15(21)19-6-2-3-8-20-9-7-18-10-20/h4-5,7,9-10H,2-3,6,8H2,1H3,(H,19,21) |
| InChIKey | AMIXPWHDKVFFBV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|