C25H27ClFN5O2 — CID 3596851
2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide (PubChem CID 3596851) has the molecular formula C25H27ClFN5O2 and a molecular weight of 483.98 g/mol. Its IUPAC name is 2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide.
| Compound Name | 2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 3596851 |
| Molecular Formula | C25H27ClFN5O2 |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[1-(2-chloro-6-fluorobenzoyl)piperidin-4-yl]-N-(3-imidazol-1-ylpropyl)-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCn2ccnc2)c(C2CCN(C(=O)c3c(F)cccc3Cl)CC2)n1 |
| InChI | InChI=1S/C25H27ClFN5O2/c1-17-6-7-19(24(33)29-10-3-12-31-15-11-28-16-31)23(30-17)18-8-13-32(14-9-18)25(34)22-20(26)4-2-5-21(22)27/h2,4-7,11,15-16,18H,3,8-10,12-14H2,1H3,(H,29,33) |
| InChIKey | YZGPBUGLBQZVMA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|