C25H29N5O2S — CID 4994763
N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 4994763) has the molecular formula C25H29N5O2S and a molecular weight of 463.61 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4994763 |
| Molecular Formula | C25H29N5O2S |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCn2ccnc2)c(C2CCN(C(=O)C=Cc3cccs3)CC2)n1 |
| InChI | InChI=1S/C25H29N5O2S/c1-19-5-7-22(25(32)27-11-3-13-29-16-12-26-18-29)24(28-19)20-9-14-30(15-10-20)23(31)8-6-21-4-2-17-33-21/h2,4-8,12,16-18,20H,3,9-11,13-15H2,1H3,(H,27,32) |
| InChIKey | SAGDKNMTGWBOBS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|