C27H33N5O2S — CID 3789960
N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[2-(4-methylsulfanylphenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 3789960) has the molecular formula C27H33N5O2S and a molecular weight of 491.66 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[2-(4-methylsulfanylphenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[2-(4-methylsulfanylphenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3789960 |
| Molecular Formula | C27H33N5O2S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[2-(4-methylsulfanylphenyl)acetyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | CSc1ccc(CC(=O)N2CCC(c3nc(C)ccc3C(=O)NCCCn3ccnc3)CC2)cc1 |
| InChI | InChI=1S/C27H33N5O2S/c1-20-4-9-24(27(34)29-12-3-14-31-17-13-28-19-31)26(30-20)22-10-15-32(16-11-22)25(33)18-21-5-7-23(35-2)8-6-21/h4-9,13,17,19,22H,3,10-12,14-16,18H2,1-2H3,(H,29,34) |
| InChIKey | PFAKVUCVFLGPIS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|