C25H28N6O5 — CID 6177910
N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 6177910) has the molecular formula C25H28N6O5 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6177910 |
| Molecular Formula | C25H28N6O5 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-methyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCCn2ccnc2)c(C2CCN(C(=O)/C=C/c3ccc([N+](=O)[O-])o3)CC2)n1 |
| InChI | InChI=1S/C25H28N6O5/c1-18-3-6-21(25(33)27-11-2-13-29-16-12-26-17-29)24(28-18)19-9-14-30(15-10-19)22(32)7-4-20-5-8-23(36-20)31(34)35/h3-8,12,16-17,19H,2,9-11,13-15H2,1H3,(H,27,33)/b7-4+ |
| InChIKey | MPCQGOPAMHLOMW-QPJJXVBHSA-N |
| XLogP | 3.33 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|