C25H27N3O2S2 — CID 3804895
6-methyl-N-(2-thiophen-2-ylethyl)-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 3804895) has the molecular formula C25H27N3O2S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 6-methyl-N-(2-thiophen-2-ylethyl)-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-(2-thiophen-2-ylethyl)-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3804895 |
| Molecular Formula | C25H27N3O2S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 6-methyl-N-(2-thiophen-2-ylethyl)-2-[1-(3-thiophen-2-ylprop-2-enoyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCc2cccs2)c(C2CCN(C(=O)C=Cc3cccs3)CC2)n1 |
| InChI | InChI=1S/C25H27N3O2S2/c1-18-6-8-22(25(30)26-13-10-21-5-3-17-32-21)24(27-18)19-11-14-28(15-12-19)23(29)9-7-20-4-2-16-31-20/h2-9,16-17,19H,10-15H2,1H3,(H,26,30) |
| InChIKey | XYMTWFNCXCWWPZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|