C26H30N4O2S2 — CID 3690110
2-[1-[(4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-6-methyl-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide (PubChem CID 3690110) has the molecular formula C26H30N4O2S2 and a molecular weight of 494.69 g/mol. Its IUPAC name is 2-[1-[(4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-6-methyl-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide.
| Compound Name | 2-[1-[(4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-6-methyl-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3690110 |
| Molecular Formula | C26H30N4O2S2 |
| Molecular Weight | 494.69 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[1-[(4-methoxyphenyl)carbamothioyl]piperidin-4-yl]-6-methyl-N-(2-thiophen-2-ylethyl)pyridine-3-carboxamide |
| SMILES | COc1ccc(NC(=S)N2CCC(c3nc(C)ccc3C(=O)NCCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C26H30N4O2S2/c1-18-5-10-23(25(31)27-14-11-22-4-3-17-34-22)24(28-18)19-12-15-30(16-13-19)26(33)29-20-6-8-21(32-2)9-7-20/h3-10,17,19H,11-16H2,1-2H3,(H,27,31)(H,29,33) |
| InChIKey | WMXSXMJJPKCZOT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|