C25H26N4O6 — CID 6298335
N-(furan-2-ylmethyl)-N,6-dimethyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 6298335) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N,6-dimethyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-N,6-dimethyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 6298335 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-(furan-2-ylmethyl)-N,6-dimethyl-2-[1-[(E)-3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccco2)c(C2CCN(C(=O)/C=C/c3ccc([N+](=O)[O-])o3)CC2)n1 |
| InChI | InChI=1S/C25H26N4O6/c1-17-5-8-21(25(31)27(2)16-20-4-3-15-34-20)24(26-17)18-11-13-28(14-12-18)22(30)9-6-19-7-10-23(35-19)29(32)33/h3-10,15,18H,11-14,16H2,1-2H3/b9-6+ |
| InChIKey | LALRGYFLBLMJAS-RMKNXTFCSA-N |
| XLogP | 4.18 |
| TPSA | 122.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|