C24H21N5O6 — CID 3499182
2-[[2-[1-[3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]imidazol-1-yl]methyl]isoindole-1,3-dione (PubChem CID 3499182) has the molecular formula C24H21N5O6 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-[[2-[1-[3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]imidazol-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-[1-[3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]imidazol-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 3499182 |
| Molecular Formula | C24H21N5O6 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 2-[[2-[1-[3-(5-nitrofuran-2-yl)prop-2-enoyl]piperidin-4-yl]imidazol-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)N1CCC(c2nccn2CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C24H21N5O6/c30-20(7-5-17-6-8-21(35-17)29(33)34)26-12-9-16(10-13-26)22-25-11-14-27(22)15-28-23(31)18-3-1-2-4-19(18)24(28)32/h1-8,11,14,16H,9-10,12-13,15H2 |
| InChIKey | ICEAZYUCBJMTOK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 131.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|