C23H21F3N4O4 — CID 3812562
3-(5-nitrofuran-2-yl)-1-[4-[1-[[2-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 3812562) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 3-(5-nitrofuran-2-yl)-1-[4-[1-[[2-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(5-nitrofuran-2-yl)-1-[4-[1-[[2-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3812562 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-(5-nitrofuran-2-yl)-1-[4-[1-[[2-(trifluoromethyl)phenyl]methyl]imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)N1CCC(c2nccn2Cc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H21F3N4O4/c24-23(25,26)19-4-2-1-3-17(19)15-29-14-11-27-22(29)16-9-12-28(13-10-16)20(31)7-5-18-6-8-21(34-18)30(32)33/h1-8,11,14,16H,9-10,12-13,15H2 |
| InChIKey | QUNVNEKKQRHXBP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 94.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|