C26H30N4O5 — CID 6116328
(E)-3-(5-nitrofuran-2-yl)-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 6116328) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is (E)-3-(5-nitrofuran-2-yl)-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(5-nitrofuran-2-yl)-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6116328 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | (E)-3-(5-nitrofuran-2-yl)-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])o1)N1CCC(c2nccn2CCCCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N4O5/c31-24(10-8-23-9-11-25(35-23)30(32)33)28-16-12-22(13-17-28)26-27-14-18-29(26)15-4-5-19-34-20-21-6-2-1-3-7-21/h1-3,6-11,14,18,22H,4-5,12-13,15-17,19-20H2/b10-8+ |
| InChIKey | ZCFAWABGCQRKAO-CSKARUKUSA-N |
| XLogP | 4.80 |
| TPSA | 103.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|