C25H30ClN3O3S — CID 3540469
(5-chloro-4-methoxythiophen-3-yl)-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]methanone (PubChem CID 3540469) has the molecular formula C25H30ClN3O3S and a molecular weight of 488.05 g/mol. Its IUPAC name is (5-chloro-4-methoxythiophen-3-yl)-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | (5-chloro-4-methoxythiophen-3-yl)-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 3540469 |
| Molecular Formula | C25H30ClN3O3S |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (5-chloro-4-methoxythiophen-3-yl)-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]methanone |
| SMILES | COc1c(C(=O)N2CCC(c3nccn3CCCCOCc3ccccc3)CC2)csc1Cl |
| InChI | InChI=1S/C25H30ClN3O3S/c1-31-22-21(18-33-23(22)26)25(30)29-13-9-20(10-14-29)24-27-11-15-28(24)12-5-6-16-32-17-19-7-3-2-4-8-19/h2-4,7-8,11,15,18,20H,5-6,9-10,12-14,16-17H2,1H3 |
| InChIKey | KXODZSGYODPSCS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|