C29H31F4N3O2 — CID 3252029
3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 3252029) has the molecular formula C29H31F4N3O2 and a molecular weight of 529.58 g/mol. Its IUPAC name is 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3252029 |
| Molecular Formula | C29H31F4N3O2 |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3-[2-fluoro-5-(trifluoromethyl)phenyl]-1-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(C(F)(F)F)ccc1F)N1CCC(c2nccn2CCCCOCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H31F4N3O2/c30-26-10-9-25(29(31,32)33)20-24(26)8-11-27(37)35-16-12-23(13-17-35)28-34-14-18-36(28)15-4-5-19-38-21-22-6-2-1-3-7-22/h1-3,6-11,14,18,20,23H,4-5,12-13,15-17,19,21H2 |
| InChIKey | ZZBZFDPNJWKZBV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|