C29H33N3O3 — CID 5006046
3-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidine-1-carbonyl]-2,3-dihydroinden-1-one (PubChem CID 5006046) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 3-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidine-1-carbonyl]-2,3-dihydroinden-1-one.
| Compound Name | 3-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidine-1-carbonyl]-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 5006046 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 3-[4-[1-(4-phenylmethoxybutyl)imidazol-2-yl]piperidine-1-carbonyl]-2,3-dihydroinden-1-one |
| SMILES | O=C1CC(C(=O)N2CCC(c3nccn3CCCCOCc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C29H33N3O3/c33-27-20-26(24-10-4-5-11-25(24)27)29(34)32-16-12-23(13-17-32)28-30-14-18-31(28)15-6-7-19-35-21-22-8-2-1-3-9-22/h1-5,8-11,14,18,23,26H,6-7,12-13,15-17,19-21H2 |
| InChIKey | RIQNYCVPLQBBBW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|