C21H31N5O — CID 72867590
4-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-(2-phenylethyl)piperidine-1-carboxamide (PubChem CID 72867590) has the molecular formula C21H31N5O and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-(2-phenylethyl)piperidine-1-carboxamide.
| Compound Name | 4-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-(2-phenylethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 72867590 |
| Molecular Formula | C21H31N5O |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 4-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]-N-(2-phenylethyl)piperidine-1-carboxamide |
| SMILES | CN(C)CCn1ccnc1C1CCN(C(=O)NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H31N5O/c1-24(2)16-17-25-15-12-22-20(25)19-9-13-26(14-10-19)21(27)23-11-8-18-6-4-3-5-7-18/h3-7,12,15,19H,8-11,13-14,16-17H2,1-2H3,(H,23,27) |
| InChIKey | RQSLISMVOKJXBB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |