C20H26N6O — CID 97193180
(3R)-N-(3-cyanophenyl)-3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidine-1-carboxamide (PubChem CID 97193180) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is (3R)-N-(3-cyanophenyl)-3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidine-1-carboxamide.
| Compound Name | (3R)-N-(3-cyanophenyl)-3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97193180 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (3R)-N-(3-cyanophenyl)-3-[1-[2-(dimethylamino)ethyl]imidazol-2-yl]piperidine-1-carboxamide |
| SMILES | CN(C)CCn1ccnc1[C@@H]1CCCN(C(=O)Nc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C20H26N6O/c1-24(2)11-12-25-10-8-22-19(25)17-6-4-9-26(15-17)20(27)23-18-7-3-5-16(13-18)14-21/h3,5,7-8,10,13,17H,4,6,9,11-12,15H2,1-2H3,(H,23,27)/t17-/m1/s1 |
| InChIKey | OGCNDNJVEVBNIR-QGZVFWFLSA-N |
| XLogP | 2.73 |
| TPSA | 77.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |