C16H23N5O — CID 113105776
N-(3-cyanophenyl)-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide (PubChem CID 113105776) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide.
| Compound Name | N-(3-cyanophenyl)-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105776 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-(3-cyanophenyl)-4-[2-(dimethylamino)ethyl]piperazine-1-carboxamide |
| SMILES | CN(C)CCN1CCN(C(=O)Nc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C16H23N5O/c1-19(2)6-7-20-8-10-21(11-9-20)16(22)18-15-5-3-4-14(12-15)13-17/h3-5,12H,6-11H2,1-2H3,(H,18,22) |
| InChIKey | HYJVJDQVEZHEQG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |