C21H24N4O3 — CID 113109998
N-(3-cyanophenyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide (PubChem CID 113109998) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | N-(3-cyanophenyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113109998 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-(3-cyanophenyl)-4-[(3,4-dimethoxyphenyl)methyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(CN2CCN(C(=O)Nc3cccc(C#N)c3)CC2)cc1OC |
| InChI | InChI=1S/C21H24N4O3/c1-27-19-7-6-17(13-20(19)28-2)15-24-8-10-25(11-9-24)21(26)23-18-5-3-4-16(12-18)14-22/h3-7,12-13H,8-11,15H2,1-2H3,(H,23,26) |
| InChIKey | KVLXUYSRSSIIIU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |