C27H36N4O2S — CID 3703018
2-[1-[2-(cyclohexen-1-yl)ethylcarbamothioyl]piperidin-4-yl]-N-(furan-2-ylmethyl)-N,6-dimethylpyridine-3-carboxamide (PubChem CID 3703018) has the molecular formula C27H36N4O2S and a molecular weight of 480.68 g/mol. Its IUPAC name is 2-[1-[2-(cyclohexen-1-yl)ethylcarbamothioyl]piperidin-4-yl]-N-(furan-2-ylmethyl)-N,6-dimethylpyridine-3-carboxamide.
| Compound Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamothioyl]piperidin-4-yl]-N-(furan-2-ylmethyl)-N,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 3703018 |
| Molecular Formula | C27H36N4O2S |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-[1-[2-(cyclohexen-1-yl)ethylcarbamothioyl]piperidin-4-yl]-N-(furan-2-ylmethyl)-N,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccco2)c(C2CCN(C(=S)NCCC3=CCCCC3)CC2)n1 |
| InChI | InChI=1S/C27H36N4O2S/c1-20-10-11-24(26(32)30(2)19-23-9-6-18-33-23)25(29-20)22-13-16-31(17-14-22)27(34)28-15-12-21-7-4-3-5-8-21/h6-7,9-11,18,22H,3-5,8,12-17,19H2,1-2H3,(H,28,34) |
| InChIKey | PUBYZRNUVMAILK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|