C20H29N3O3 — CID 119073948
1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(furan-2-ylmethyl)piperidine-1,4-dicarboxamide (PubChem CID 119073948) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(furan-2-ylmethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(furan-2-ylmethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 119073948 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(furan-2-ylmethyl)piperidine-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccco1)C1CCN(C(=O)NCCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C20H29N3O3/c24-19(22-15-18-7-4-14-26-18)17-9-12-23(13-10-17)20(25)21-11-8-16-5-2-1-3-6-16/h4-5,7,14,17H,1-3,6,8-13,15H2,(H,21,25)(H,22,24) |
| InChIKey | QNETUKDBABMMEG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|