C25H35N5O4S — CID 3350598
2-[1-[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]piperidin-4-yl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-6-methylpyridine-3-carboxamide (PubChem CID 3350598) has the molecular formula C25H35N5O4S and a molecular weight of 501.65 g/mol. Its IUPAC name is 2-[1-[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]piperidin-4-yl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 2-[1-[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]piperidin-4-yl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 3350598 |
| Molecular Formula | C25H35N5O4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 2-[1-[4-(2,2-dimethylhydrazinyl)-4-oxobutanoyl]piperidin-4-yl]-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-6-methylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCCSCc2ccco2)c(C2CCN(C(=O)CCC(=O)NN(C)C)CC2)n1 |
| InChI | InChI=1S/C25H35N5O4S/c1-18-6-7-21(25(33)26-12-16-35-17-20-5-4-15-34-20)24(27-18)19-10-13-30(14-11-19)23(32)9-8-22(31)28-29(2)3/h4-7,15,19H,8-14,16-17H2,1-3H3,(H,26,33)(H,28,31) |
| InChIKey | USQGLGWPHKRXFQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|