C23H35N3O4 — CID 3852421
6-methyl-2-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide (PubChem CID 3852421) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is 6-methyl-2-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-methyl-2-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 3852421 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 6-methyl-2-[1-(3-prop-2-enoxypropanoyl)piperidin-4-yl]-N-(2-propoxyethyl)pyridine-3-carboxamide |
| SMILES | C=CCOCCC(=O)N1CCC(c2nc(C)ccc2C(=O)NCCOCCC)CC1 |
| InChI | InChI=1S/C23H35N3O4/c1-4-14-29-16-10-21(27)26-12-8-19(9-13-26)22-20(7-6-18(3)25-22)23(28)24-11-17-30-15-5-2/h4,6-7,19H,1,5,8-17H2,2-3H3,(H,24,28) |
| InChIKey | LJJZEJZPHKTGRW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|