C22H28ClN3O3S — CID 5183446
2-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide (PubChem CID 5183446) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide.
| Compound Name | 2-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 5183446 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 2-[1-(5-chlorothiophene-2-carbonyl)piperidin-4-yl]-6-methyl-N-(2-propoxyethyl)pyridine-3-carboxamide |
| SMILES | CCCOCCNC(=O)c1ccc(C)nc1C1CCN(C(=O)c2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C22H28ClN3O3S/c1-3-13-29-14-10-24-21(27)17-5-4-15(2)25-20(17)16-8-11-26(12-9-16)22(28)18-6-7-19(23)30-18/h4-7,16H,3,8-14H2,1-2H3,(H,24,27) |
| InChIKey | AXWGGOUGZHAZDA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|